C20H17ClN2O6S — CID 18579698
ethyl 4-(3-chlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate (PubChem CID 18579698) has the molecular formula C20H17ClN2O6S and a molecular weight of 448.88 g/mol. Its IUPAC name is ethyl 4-(3-chlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 4-(3-chlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18579698 |
| Molecular Formula | C20H17ClN2O6S |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | ethyl 4-(3-chlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)cc2)c(=O)cc1OS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H17ClN2O6S/c1-3-28-20(25)19-17(29-30(26,27)16-6-4-5-14(21)11-16)12-18(24)23(22-19)15-9-7-13(2)8-10-15/h4-12H,3H2,1-2H3 |
| InChIKey | HIMVBPBJUZGFLR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|