C20H16Cl2N2O6S — CID 43993040
ethyl 4-(2,5-dichlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate (PubChem CID 43993040) has the molecular formula C20H16Cl2N2O6S and a molecular weight of 483.33 g/mol. Its IUPAC name is ethyl 4-(2,5-dichlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 4-(2,5-dichlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 43993040 |
| Molecular Formula | C20H16Cl2N2O6S |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | ethyl 4-(2,5-dichlorophenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)cc2)c(=O)cc1OS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H16Cl2N2O6S/c1-3-29-20(26)19-16(30-31(27,28)17-10-13(21)6-9-15(17)22)11-18(25)24(23-19)14-7-4-12(2)5-8-14/h4-11H,3H2,1-2H3 |
| InChIKey | WVZNLODWPSIFCC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|