C20H18N2O6S — CID 7386777
ethyl 4-(3-methylphenyl)sulfonyloxy-6-oxo-1-phenylpyridazine-3-carboxylate (PubChem CID 7386777) has the molecular formula C20H18N2O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is ethyl 4-(3-methylphenyl)sulfonyloxy-6-oxo-1-phenylpyridazine-3-carboxylate.
| Compound Name | ethyl 4-(3-methylphenyl)sulfonyloxy-6-oxo-1-phenylpyridazine-3-carboxylate |
|---|---|
| PubChem CID | 7386777 |
| Molecular Formula | C20H18N2O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | ethyl 4-(3-methylphenyl)sulfonyloxy-6-oxo-1-phenylpyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)c(=O)cc1OS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C20H18N2O6S/c1-3-27-20(24)19-17(28-29(25,26)16-11-7-8-14(2)12-16)13-18(23)22(21-19)15-9-5-4-6-10-15/h4-13H,3H2,1-2H3 |
| InChIKey | KSCKWOFEXXHSPE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|