C22H22N2O7S — CID 43993012
ethyl 4-(4-ethoxyphenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate (PubChem CID 43993012) has the molecular formula C22H22N2O7S and a molecular weight of 458.49 g/mol. Its IUPAC name is ethyl 4-(4-ethoxyphenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 4-(4-ethoxyphenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 43993012 |
| Molecular Formula | C22H22N2O7S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | ethyl 4-(4-ethoxyphenyl)sulfonyloxy-1-(4-methylphenyl)-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)cc2)c(=O)cc1OS(=O)(=O)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C22H22N2O7S/c1-4-29-17-10-12-18(13-11-17)32(27,28)31-19-14-20(25)24(16-8-6-15(3)7-9-16)23-21(19)22(26)30-5-2/h6-14H,4-5H2,1-3H3 |
| InChIKey | DPCXSDWHYMHAGC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 113.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|