C20H13ClF4N2O6S — CID 16874274
ethyl 1-(2-chlorophenyl)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyloxy-6-oxopyridazine-3-carboxylate (PubChem CID 16874274) has the molecular formula C20H13ClF4N2O6S and a molecular weight of 520.84 g/mol. Its IUPAC name is ethyl 1-(2-chlorophenyl)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyloxy-6-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 1-(2-chlorophenyl)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyloxy-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 16874274 |
| Molecular Formula | C20H13ClF4N2O6S |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.01 |
| IUPAC Name | ethyl 1-(2-chlorophenyl)-4-[4-fluoro-3-(trifluoromethyl)phenyl]sulfonyloxy-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2Cl)c(=O)cc1OS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13ClF4N2O6S/c1-2-32-19(29)18-16(10-17(28)27(26-18)15-6-4-3-5-13(15)21)33-34(30,31)11-7-8-14(22)12(9-11)20(23,24)25/h3-10H,2H2,1H3 |
| InChIKey | ACJMBHKYKAPTKV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 104.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|