C24H18ClN5O5S2 — CID 10120247
8-[(2-chlorophenyl)sulfonylamino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide (PubChem CID 10120247) has the molecular formula C24H18ClN5O5S2 and a molecular weight of 556.03 g/mol. Its IUPAC name is 8-[(2-chlorophenyl)sulfonylamino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide.
| Compound Name | 8-[(2-chlorophenyl)sulfonylamino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide |
|---|---|
| PubChem CID | 10120247 |
| Molecular Formula | C24H18ClN5O5S2 |
| Molecular Weight | 556.03 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | 8-[(2-chlorophenyl)sulfonylamino]-1-(4-sulfamoylphenyl)benzo[g]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(-c2ccc(S(N)(=O)=O)cc2)c2c1ccc1ccc(NS(=O)(=O)c3ccccc3Cl)cc12 |
| InChI | InChI=1S/C24H18ClN5O5S2/c25-20-3-1-2-4-21(20)37(34,35)29-15-7-5-14-6-12-18-22(24(26)31)28-30(23(18)19(14)13-15)16-8-10-17(11-9-16)36(27,32)33/h1-13,29H,(H2,26,31)(H2,27,32,33) |
| InChIKey | AMMVEXZQWZFDSY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.03 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |