C10H11N5O4S — CID 107346339
methyl 4-amino-1-(5-sulfamoyl-2-pyridinyl)pyrazole-3-carboxylate (PubChem CID 107346339) has the molecular formula C10H11N5O4S and a molecular weight of 297.30 g/mol. Its IUPAC name is methyl 4-amino-1-(5-sulfamoyl-2-pyridinyl)pyrazole-3-carboxylate.
| Compound Name | methyl 4-amino-1-(5-sulfamoyl-2-pyridinyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 107346339 |
| Molecular Formula | C10H11N5O4S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | methyl 4-amino-1-(5-sulfamoyl-2-pyridinyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2ccc(S(N)(=O)=O)cn2)cc1N |
| InChI | InChI=1S/C10H11N5O4S/c1-19-10(16)9-7(11)5-15(14-9)8-3-2-6(4-13-8)20(12,17)18/h2-5H,11H2,1H3,(H2,12,17,18) |
| InChIKey | UBNBYBYYCJLDFD-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 143.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |