C16H24N2O4S — CID 167519802
2-methylpropyl 1-(4-sulfamoylphenyl)piperidine-4-carboxylate (PubChem CID 167519802) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-methylpropyl 1-(4-sulfamoylphenyl)piperidine-4-carboxylate.
| Compound Name | 2-methylpropyl 1-(4-sulfamoylphenyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 167519802 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-methylpropyl 1-(4-sulfamoylphenyl)piperidine-4-carboxylate |
| SMILES | CC(C)COC(=O)C1CCN(c2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C16H24N2O4S/c1-12(2)11-22-16(19)13-7-9-18(10-8-13)14-3-5-15(6-4-14)23(17,20)21/h3-6,12-13H,7-11H2,1-2H3,(H2,17,20,21) |
| InChIKey | VTMHTAMWKZHXKK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |