C27H36N2O5S2 — CID 174945351
bis[1-(4-ethylsulfonylphenyl)piperidin-4-yl]methanone (PubChem CID 174945351) has the molecular formula C27H36N2O5S2 and a molecular weight of 532.73 g/mol. Its IUPAC name is bis[1-(4-ethylsulfonylphenyl)piperidin-4-yl]methanone.
| Compound Name | bis[1-(4-ethylsulfonylphenyl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 174945351 |
| Molecular Formula | C27H36N2O5S2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | bis[1-(4-ethylsulfonylphenyl)piperidin-4-yl]methanone |
| SMILES | CCS(=O)(=O)c1ccc(N2CCC(C(=O)C3CCN(c4ccc(S(=O)(=O)CC)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H36N2O5S2/c1-3-35(31,32)25-9-5-23(6-10-25)28-17-13-21(14-18-28)27(30)22-15-19-29(20-16-22)24-7-11-26(12-8-24)36(33,34)4-2/h5-12,21-22H,3-4,13-20H2,1-2H3 |
| InChIKey | OOIWDYPGJFMVHU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |