C16H21NO5S — CID 119166185
1-[2-(4-ethylsulfonylphenyl)acetyl]piperidine-4-carboxylic acid (PubChem CID 119166185) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 1-[2-(4-ethylsulfonylphenyl)acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(4-ethylsulfonylphenyl)acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 119166185 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-[2-(4-ethylsulfonylphenyl)acetyl]piperidine-4-carboxylic acid |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-2-23(21,22)14-5-3-12(4-6-14)11-15(18)17-9-7-13(8-10-17)16(19)20/h3-6,13H,2,7-11H2,1H3,(H,19,20) |
| InChIKey | SPBGBPMJQPSVAK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |