C17H23NO5S — CID 119229254
4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 119229254) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119229254 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[[2-(4-ethylsulfonylphenyl)acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)NC2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C17H23NO5S/c1-2-24(22,23)15-9-3-12(4-10-15)11-16(19)18-14-7-5-13(6-8-14)17(20)21/h3-4,9-10,13-14H,2,5-8,11H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | VHTBZMROAKRJTP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |