C15H14FNO2S — CID 124745711
(1R,2R,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropan-1-amine (PubChem CID 124745711) has the molecular formula C15H14FNO2S and a molecular weight of 291.35 g/mol. Its IUPAC name is (1R,2R,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropan-1-amine.
| Compound Name | (1R,2R,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 124745711 |
| Molecular Formula | C15H14FNO2S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (1R,2R,3S)-2-(benzenesulfonyl)-3-(4-fluorophenyl)cyclopropan-1-amine |
| SMILES | N[C@@H]1[C@H](c2ccc(F)cc2)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14FNO2S/c16-11-8-6-10(7-9-11)13-14(17)15(13)20(18,19)12-4-2-1-3-5-12/h1-9,13-15H,17H2/t13-,14+,15+/m0/s1 |
| InChIKey | HLGWVPWZGOSSBP-RRFJBIMHSA-N |
| XLogP | 2.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |