C16H20F2N2O3 — CID 75391109
N-but-3-en-2-yl-2-[3-(difluoromethoxy)phenyl]morpholine-4-carboxamide (PubChem CID 75391109) has the molecular formula C16H20F2N2O3 and a molecular weight of 326.34 g/mol. Its IUPAC name is N-but-3-en-2-yl-2-[3-(difluoromethoxy)phenyl]morpholine-4-carboxamide.
| Compound Name | N-but-3-en-2-yl-2-[3-(difluoromethoxy)phenyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 75391109 |
| Molecular Formula | C16H20F2N2O3 |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-but-3-en-2-yl-2-[3-(difluoromethoxy)phenyl]morpholine-4-carboxamide |
| SMILES | C=CC(C)NC(=O)N1CCOC(c2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C16H20F2N2O3/c1-3-11(2)19-16(21)20-7-8-22-14(10-20)12-5-4-6-13(9-12)23-15(17)18/h3-6,9,11,14-15H,1,7-8,10H2,2H3,(H,19,21) |
| InChIKey | RPMZUMGVUSXDHP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|