C13H15F2NO4 — CID 136545989
1-[2-[4-(difluoromethoxy)phenyl]morpholin-4-yl]-2-hydroxyethanone (PubChem CID 136545989) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-[2-[4-(difluoromethoxy)phenyl]morpholin-4-yl]-2-hydroxyethanone.
| Compound Name | 1-[2-[4-(difluoromethoxy)phenyl]morpholin-4-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 136545989 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[2-[4-(difluoromethoxy)phenyl]morpholin-4-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCOC(c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C13H15F2NO4/c14-13(15)20-10-3-1-9(2-4-10)11-7-16(5-6-19-11)12(18)8-17/h1-4,11,13,17H,5-8H2 |
| InChIKey | JKDJJFHTKUHTKG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |