C15H17F2NO5S — CID 120551759
2-[2-[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-2-oxoethyl]sulfanylacetic acid (PubChem CID 120551759) has the molecular formula C15H17F2NO5S and a molecular weight of 361.37 g/mol. Its IUPAC name is 2-[2-[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 120551759 |
| Molecular Formula | C15H17F2NO5S |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-[2-[2-[3-(difluoromethoxy)phenyl]morpholin-4-yl]-2-oxoethyl]sulfanylacetic acid |
| SMILES | O=C(O)CSCC(=O)N1CCOC(c2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C15H17F2NO5S/c16-15(17)23-11-3-1-2-10(6-11)12-7-18(4-5-22-12)13(19)8-24-9-14(20)21/h1-3,6,12,15H,4-5,7-9H2,(H,20,21) |
| InChIKey | UHXUTLJDVZQMCJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |