C17H19F2NO3 — CID 91650407
2-[3-(difluoromethoxy)phenyl]-4-[1-(furan-2-yl)ethyl]morpholine (PubChem CID 91650407) has the molecular formula C17H19F2NO3 and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)phenyl]-4-[1-(furan-2-yl)ethyl]morpholine.
| Compound Name | 2-[3-(difluoromethoxy)phenyl]-4-[1-(furan-2-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 91650407 |
| Molecular Formula | C17H19F2NO3 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[3-(difluoromethoxy)phenyl]-4-[1-(furan-2-yl)ethyl]morpholine |
| SMILES | CC(c1ccco1)N1CCOC(c2cccc(OC(F)F)c2)C1 |
| InChI | InChI=1S/C17H19F2NO3/c1-12(15-6-3-8-21-15)20-7-9-22-16(11-20)13-4-2-5-14(10-13)23-17(18)19/h2-6,8,10,12,16-17H,7,9,11H2,1H3 |
| InChIKey | PBLIJGIWJAGNAC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |