C15H21N3OS — CID 124884004
(2R)-4-[2-(2-ethylpyrazol-3-yl)ethyl]-2-thiophen-3-ylmorpholine (PubChem CID 124884004) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is (2R)-4-[2-(2-ethylpyrazol-3-yl)ethyl]-2-thiophen-3-ylmorpholine.
| Compound Name | (2R)-4-[2-(2-ethylpyrazol-3-yl)ethyl]-2-thiophen-3-ylmorpholine |
|---|---|
| PubChem CID | 124884004 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (2R)-4-[2-(2-ethylpyrazol-3-yl)ethyl]-2-thiophen-3-ylmorpholine |
| SMILES | CCn1nccc1CCN1CCO[C@H](c2ccsc2)C1 |
| InChI | InChI=1S/C15H21N3OS/c1-2-18-14(3-6-16-18)4-7-17-8-9-19-15(11-17)13-5-10-20-12-13/h3,5-6,10,12,15H,2,4,7-9,11H2,1H3/t15-/m0/s1 |
| InChIKey | UCYCLFRXKJEMJG-HNNXBMFYSA-N |
| XLogP | 2.58 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |