C16H20N2O3S — CID 124622385
(2R)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-thiophen-3-ylmorpholine (PubChem CID 124622385) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is (2R)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-thiophen-3-ylmorpholine.
| Compound Name | (2R)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-thiophen-3-ylmorpholine |
|---|---|
| PubChem CID | 124622385 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2R)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-2-thiophen-3-ylmorpholine |
| SMILES | COc1ccnc(CN2CCO[C@H](c3ccsc3)C2)c1OC |
| InChI | InChI=1S/C16H20N2O3S/c1-19-14-3-5-17-13(16(14)20-2)9-18-6-7-21-15(10-18)12-4-8-22-11-12/h3-5,8,11,15H,6-7,9-10H2,1-2H3/t15-/m0/s1 |
| InChIKey | MYNMMAFTLAGRRJ-HNNXBMFYSA-N |
| XLogP | 2.73 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |