C13H21N3O2 — CID 103173642
(3R)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-methylpiperazine (PubChem CID 103173642) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is (3R)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-methylpiperazine.
| Compound Name | (3R)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 103173642 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (3R)-1-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-methylpiperazine |
| SMILES | COc1ccnc(CN2CCN[C@H](C)C2)c1OC |
| InChI | InChI=1S/C13H21N3O2/c1-10-8-16(7-6-14-10)9-11-13(18-3)12(17-2)4-5-15-11/h4-5,10,14H,6-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | OIZGBZPURZTIBY-SNVBAGLBSA-N |
| XLogP | 0.89 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |