C16H22N4O2 — CID 122139214
3,4-dimethoxy-2-[[3-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]pyridine (PubChem CID 122139214) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3,4-dimethoxy-2-[[3-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]pyridine.
| Compound Name | 3,4-dimethoxy-2-[[3-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 122139214 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3,4-dimethoxy-2-[[3-(1H-pyrazol-5-yl)piperidin-1-yl]methyl]pyridine |
| SMILES | COc1ccnc(CN2CCCC(c3ccn[nH]3)C2)c1OC |
| InChI | InChI=1S/C16H22N4O2/c1-21-15-6-7-17-14(16(15)22-2)11-20-9-3-4-12(10-20)13-5-8-18-19-13/h5-8,12H,3-4,9-11H2,1-2H3,(H,18,19) |
| InChIKey | GBVZFYALRWMURL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |