C14H21BrN2O2 — CID 103174046
2-[[3-(2-bromoethyl)pyrrolidin-1-yl]methyl]-3,4-dimethoxypyridine (PubChem CID 103174046) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 2-[[3-(2-bromoethyl)pyrrolidin-1-yl]methyl]-3,4-dimethoxypyridine.
| Compound Name | 2-[[3-(2-bromoethyl)pyrrolidin-1-yl]methyl]-3,4-dimethoxypyridine |
|---|---|
| PubChem CID | 103174046 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[[3-(2-bromoethyl)pyrrolidin-1-yl]methyl]-3,4-dimethoxypyridine |
| SMILES | COc1ccnc(CN2CCC(CCBr)C2)c1OC |
| InChI | InChI=1S/C14H21BrN2O2/c1-18-13-4-7-16-12(14(13)19-2)10-17-8-5-11(9-17)3-6-15/h4,7,11H,3,5-6,8-10H2,1-2H3 |
| InChIKey | FZWRXGYBHQPPJY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|