C11H16N2O3 — CID 103173821
1-[(3,4-dimethoxy-2-pyridinyl)methyl]azetidin-3-ol (PubChem CID 103173821) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-[(3,4-dimethoxy-2-pyridinyl)methyl]azetidin-3-ol.
| Compound Name | 1-[(3,4-dimethoxy-2-pyridinyl)methyl]azetidin-3-ol |
|---|---|
| PubChem CID | 103173821 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-[(3,4-dimethoxy-2-pyridinyl)methyl]azetidin-3-ol |
| SMILES | COc1ccnc(CN2CC(O)C2)c1OC |
| InChI | InChI=1S/C11H16N2O3/c1-15-10-3-4-12-9(11(10)16-2)7-13-5-8(14)6-13/h3-4,8,14H,5-7H2,1-2H3 |
| InChIKey | AALAECQXGZYDJP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |