C18H22N2O3 — CID 124729387
(3S)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-phenylmorpholine (PubChem CID 124729387) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (3S)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-phenylmorpholine.
| Compound Name | (3S)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-phenylmorpholine |
|---|---|
| PubChem CID | 124729387 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (3S)-4-[(3,4-dimethoxy-2-pyridinyl)methyl]-3-phenylmorpholine |
| SMILES | COc1ccnc(CN2CCOC[C@@H]2c2ccccc2)c1OC |
| InChI | InChI=1S/C18H22N2O3/c1-21-17-8-9-19-15(18(17)22-2)12-20-10-11-23-13-16(20)14-6-4-3-5-7-14/h3-9,16H,10-13H2,1-2H3/t16-/m1/s1 |
| InChIKey | GBGPLSUVYSKSKK-MRXNPFEDSA-N |
| XLogP | 2.67 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |