C18H29N3O3 — CID 138033013
2-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]piperidin-4-yl]oxan-3-amine (PubChem CID 138033013) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]piperidin-4-yl]oxan-3-amine.
| Compound Name | 2-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]piperidin-4-yl]oxan-3-amine |
|---|---|
| PubChem CID | 138033013 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 2-[1-[(3,4-dimethoxy-2-pyridinyl)methyl]piperidin-4-yl]oxan-3-amine |
| SMILES | COc1ccnc(CN2CCC(C3OCCCC3N)CC2)c1OC |
| InChI | InChI=1S/C18H29N3O3/c1-22-16-5-8-20-15(18(16)23-2)12-21-9-6-13(7-10-21)17-14(19)4-3-11-24-17/h5,8,13-14,17H,3-4,6-7,9-12,19H2,1-2H3 |
| InChIKey | WJICZTGHKCEUIJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |