C19H17FN6O2 — CID 127249072
[2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone (PubChem CID 127249072) has the molecular formula C19H17FN6O2 and a molecular weight of 380.38 g/mol. Its IUPAC name is [2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone.
| Compound Name | [2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 127249072 |
| Molecular Formula | C19H17FN6O2 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCOC(c2ccc(Nc3ccc(F)cn3)cn2)C1 |
| InChI | InChI=1S/C19H17FN6O2/c20-13-1-4-18(24-9-13)25-14-2-3-15(23-10-14)17-12-26(7-8-28-17)19(27)16-11-21-5-6-22-16/h1-6,9-11,17H,7-8,12H2,(H,24,25) |
| InChIKey | AYNCOBLBZPHVJX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |