C22H26FN5O4 — CID 125007066
1-[2-[2-[(2R)-2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one (PubChem CID 125007066) has the molecular formula C22H26FN5O4 and a molecular weight of 443.48 g/mol. Its IUPAC name is 1-[2-[2-[(2R)-2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[2-[(2R)-2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125007066 |
| Molecular Formula | C22H26FN5O4 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 1-[2-[2-[(2R)-2-[5-[(5-fluoro-2-pyridinyl)amino]-2-pyridinyl]morpholin-4-yl]-2-oxoethoxy]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCOCC(=O)N1CCO[C@@H](c2ccc(Nc3ccc(F)cn3)cn2)C1 |
| InChI | InChI=1S/C22H26FN5O4/c23-16-3-6-20(25-12-16)26-17-4-5-18(24-13-17)19-14-28(9-11-32-19)22(30)15-31-10-8-27-7-1-2-21(27)29/h3-6,12-13,19H,1-2,7-11,14-15H2,(H,25,26)/t19-/m1/s1 |
| InChIKey | UKROVFQYRAXPBA-LJQANCHMSA-N |
| XLogP | 1.90 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|