C17H23N5O4 — CID 155493815
1-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-phenoxypropan-1-one (PubChem CID 155493815) has the molecular formula C17H23N5O4 and a molecular weight of 361.40 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-phenoxypropan-1-one.
| Compound Name | 1-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-phenoxypropan-1-one |
|---|---|
| PubChem CID | 155493815 |
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]-3-phenoxypropan-1-one |
| SMILES | COCCn1nnc(C2CN(C(=O)CCOc3ccccc3)CCO2)n1 |
| InChI | InChI=1S/C17H23N5O4/c1-24-11-9-22-19-17(18-20-22)15-13-21(8-12-26-15)16(23)7-10-25-14-5-3-2-4-6-14/h2-6,15H,7-13H2,1H3 |
| InChIKey | DDDQAQWYIFBWAP-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |