C16H21ClN6O3 — CID 155496538
N-(3-chloro-4-methylphenyl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine-4-carboxamide (PubChem CID 155496538) has the molecular formula C16H21ClN6O3 and a molecular weight of 380.84 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine-4-carboxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 155496538 |
| Molecular Formula | C16H21ClN6O3 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholine-4-carboxamide |
| SMILES | COCCn1nnc(C2CN(C(=O)Nc3ccc(C)c(Cl)c3)CCO2)n1 |
| InChI | InChI=1S/C16H21ClN6O3/c1-11-3-4-12(9-13(11)17)18-16(24)22-5-8-26-14(10-22)15-19-21-23(20-15)6-7-25-2/h3-4,9,14H,5-8,10H2,1-2H3,(H,18,24) |
| InChIKey | KSKORLPUBJZEIQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |