C18H19ClN2O2 — CID 110364497
N-(4-chlorophenyl)-2-(2-methylphenyl)morpholine-4-carboxamide (PubChem CID 110364497) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2-methylphenyl)morpholine-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-(2-methylphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 110364497 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2-methylphenyl)morpholine-4-carboxamide |
| SMILES | Cc1ccccc1C1CN(C(=O)Nc2ccc(Cl)cc2)CCO1 |
| InChI | InChI=1S/C18H19ClN2O2/c1-13-4-2-3-5-16(13)17-12-21(10-11-23-17)18(22)20-15-8-6-14(19)7-9-15/h2-9,17H,10-12H2,1H3,(H,20,22) |
| InChIKey | BDNRMSQHSKXICJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |