C21H25FN4O2 — CID 109479507
N-(4-fluorophenyl)-2-[[N-methyl-C-[2-(2-methylphenyl)morpholin-4-yl]carbonimidoyl]amino]acetamide (PubChem CID 109479507) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[[N-methyl-C-[2-(2-methylphenyl)morpholin-4-yl]carbonimidoyl]amino]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[[N-methyl-C-[2-(2-methylphenyl)morpholin-4-yl]carbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 109479507 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(4-fluorophenyl)-2-[[N-methyl-C-[2-(2-methylphenyl)morpholin-4-yl]carbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)N1CCOC(c2ccccc2C)C1 |
| InChI | InChI=1S/C21H25FN4O2/c1-15-5-3-4-6-18(15)19-14-26(11-12-28-19)21(23-2)24-13-20(27)25-17-9-7-16(22)8-10-17/h3-10,19H,11-14H2,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | VEBBYYACHXPOLC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|