C15H19N5O6S — CID 155497759
3-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]sulfonylbenzoic acid (PubChem CID 155497759) has the molecular formula C15H19N5O6S and a molecular weight of 397.41 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]sulfonylbenzoic acid.
| Compound Name | 3-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 155497759 |
| Molecular Formula | C15H19N5O6S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 3-[2-[2-(2-methoxyethyl)tetrazol-5-yl]morpholin-4-yl]sulfonylbenzoic acid |
| SMILES | COCCn1nnc(C2CN(S(=O)(=O)c3cccc(C(=O)O)c3)CCO2)n1 |
| InChI | InChI=1S/C15H19N5O6S/c1-25-7-6-20-17-14(16-18-20)13-10-19(5-8-26-13)27(23,24)12-4-2-3-11(9-12)15(21)22/h2-4,9,13H,5-8,10H2,1H3,(H,21,22) |
| InChIKey | SZKYYWOXMBLRSM-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 136.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |