C15H21N5O5S — CID 155507407
2-[2-(2-methoxyethyl)tetrazol-5-yl]-4-(4-methoxyphenyl)sulfonylmorpholine (PubChem CID 155507407) has the molecular formula C15H21N5O5S and a molecular weight of 383.43 g/mol. Its IUPAC name is 2-[2-(2-methoxyethyl)tetrazol-5-yl]-4-(4-methoxyphenyl)sulfonylmorpholine.
| Compound Name | 2-[2-(2-methoxyethyl)tetrazol-5-yl]-4-(4-methoxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 155507407 |
| Molecular Formula | C15H21N5O5S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[2-(2-methoxyethyl)tetrazol-5-yl]-4-(4-methoxyphenyl)sulfonylmorpholine |
| SMILES | COCCn1nnc(C2CN(S(=O)(=O)c3ccc(OC)cc3)CCO2)n1 |
| InChI | InChI=1S/C15H21N5O5S/c1-23-9-8-20-17-15(16-18-20)14-11-19(7-10-25-14)26(21,22)13-5-3-12(24-2)4-6-13/h3-6,14H,7-11H2,1-2H3 |
| InChIKey | QJIZIQSJRDLOMS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 108.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |