C17H23N3O6S — CID 129327274
(2R)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-4-[4-(2-methoxyethoxy)phenyl]sulfonylmorpholine (PubChem CID 129327274) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is (2R)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-4-[4-(2-methoxyethoxy)phenyl]sulfonylmorpholine.
| Compound Name | (2R)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-4-[4-(2-methoxyethoxy)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 129327274 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (2R)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-4-[4-(2-methoxyethoxy)phenyl]sulfonylmorpholine |
| SMILES | CCc1nnc([C@H]2CN(S(=O)(=O)c3ccc(OCCOC)cc3)CCO2)o1 |
| InChI | InChI=1S/C17H23N3O6S/c1-3-16-18-19-17(26-16)15-12-20(8-9-25-15)27(21,22)14-6-4-13(5-7-14)24-11-10-23-2/h4-7,15H,3,8-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | ROOGKLCXLMZAKX-OAHLLOKOSA-N |
| XLogP | 1.42 |
| TPSA | 103.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|