C18H25N3O4 — CID 95714397
1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone (PubChem CID 95714397) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone.
| Compound Name | 1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone |
|---|---|
| PubChem CID | 95714397 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[4-(3-methoxybenzoyl)piperazin-1-yl]-2-[(3R)-morpholin-3-yl]ethanone |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)C[C@@H]3COCCN3)CC2)c1 |
| InChI | InChI=1S/C18H25N3O4/c1-24-16-4-2-3-14(11-16)18(23)21-8-6-20(7-9-21)17(22)12-15-13-25-10-5-19-15/h2-4,11,15,19H,5-10,12-13H2,1H3/t15-/m1/s1 |
| InChIKey | AEHIJVWKNAHCCR-OAHLLOKOSA-N |
| XLogP | 0.36 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |