C18H25NO4 — CID 91917960
(4-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-(3-methoxyphenyl)methanone (PubChem CID 91917960) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (4-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-(3-methoxyphenyl)methanone.
| Compound Name | (4-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 91917960 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (4-methoxy-1-oxa-9-azaspiro[5.5]undecan-9-yl)-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCC3(CC2)CC(OC)CCO3)c1 |
| InChI | InChI=1S/C18H25NO4/c1-21-15-5-3-4-14(12-15)17(20)19-9-7-18(8-10-19)13-16(22-2)6-11-23-18/h3-5,12,16H,6-11,13H2,1-2H3 |
| InChIKey | DGXYNPGBYYSJCI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |