C20H25FN4OS — CID 162953535
[4,4-dimethyl-8-(1,3-thiazol-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(2-fluorophenyl)methanone (PubChem CID 162953535) has the molecular formula C20H25FN4OS and a molecular weight of 388.51 g/mol. Its IUPAC name is [4,4-dimethyl-8-(1,3-thiazol-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4,4-dimethyl-8-(1,3-thiazol-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 162953535 |
| Molecular Formula | C20H25FN4OS |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [4,4-dimethyl-8-(1,3-thiazol-2-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl]-(2-fluorophenyl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccccc2F)CC2CN(Cc3nccs3)CCN21 |
| InChI | InChI=1S/C20H25FN4OS/c1-20(2)14-24(19(26)16-5-3-4-6-17(16)21)12-15-11-23(8-9-25(15)20)13-18-22-7-10-27-18/h3-7,10,15H,8-9,11-14H2,1-2H3 |
| InChIKey | VGLUMASXAKMGEU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |