C12H11FN2OS — CID 110715660
2-fluoro-N-methyl-N-(1,3-thiazol-2-ylmethyl)benzamide (PubChem CID 110715660) has the molecular formula C12H11FN2OS and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-fluoro-N-methyl-N-(1,3-thiazol-2-ylmethyl)benzamide.
| Compound Name | 2-fluoro-N-methyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 110715660 |
| Molecular Formula | C12H11FN2OS |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-fluoro-N-methyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
| SMILES | CN(Cc1nccs1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C12H11FN2OS/c1-15(8-11-14-6-7-17-11)12(16)9-4-2-3-5-10(9)13/h2-7H,8H2,1H3 |
| InChIKey | ITZRHXUNCWFQNT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |