C14H16N2O2S — CID 131946527
2-methoxy-N,6-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzamide (PubChem CID 131946527) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-methoxy-N,6-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzamide.
| Compound Name | 2-methoxy-N,6-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 131946527 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-methoxy-N,6-dimethyl-N-(1,3-thiazol-2-ylmethyl)benzamide |
| SMILES | COc1cccc(C)c1C(=O)N(C)Cc1nccs1 |
| InChI | InChI=1S/C14H16N2O2S/c1-10-5-4-6-11(18-3)13(10)14(17)16(2)9-12-15-7-8-19-12/h4-8H,9H2,1-3H3 |
| InChIKey | YJXVPNMPPCWNAV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |