C12H13NOS — CID 103825960
2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazole (PubChem CID 103825960) has the molecular formula C12H13NOS and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 103825960 |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 2-[(2,3-dimethylphenoxy)methyl]-1,3-thiazole |
| SMILES | Cc1cccc(OCc2nccs2)c1C |
| InChI | InChI=1S/C12H13NOS/c1-9-4-3-5-11(10(9)2)14-8-12-13-6-7-15-12/h3-7H,8H2,1-2H3 |
| InChIKey | SRZYNONXVSROFX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |