About [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol
[2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol (PubChem CID 82434183) has the molecular formula C16H21NO2S
and a molecular weight of 291.42 g/mol. Its IUPAC name is [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol |
| PubChem CID | 82434183 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol |
| SMILES | Cc1cccc(OCc2nc(C(C)C)c(CO)s2)c1C |
| InChI | InChI=1S/C16H21NO2S/c1-10(2)16-14(8-18)20-15(17-16)9-19-13-7-5-6-11(3)12(13)4/h5-7,10,18H,8-9H2,1-4H3 |
| InChIKey | RGHFKJIMCAIDOW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol?
The IUPAC name of [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol (CID 82434183) is [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol is Cc1cccc(OCc2nc(C(C)C)c(CO)s2)c1C.
What is the InChIKey of [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol?
The InChIKey is RGHFKJIMCAIDOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2S/c1-10(2)16-14(8-18)20-15(17-16)9-19-13-7-5-6-11(3)12(13)4/h5-7,10,18H,8-9H2,1-4H3.
What are the key properties of [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol?
[2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol has a molecular weight of 291.42 g/mol, XLogP of 3.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,3-dimethylphenoxy)methyl]-4-propan-2-yl-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 82434183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).