About 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine
3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine (PubChem CID 62464069) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine |
| PubChem CID | 62464069 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine |
| SMILES | CNc1ncccc1COc1cccc(C)c1C |
| InChI | InChI=1S/C15H18N2O/c1-11-6-4-8-14(12(11)2)18-10-13-7-5-9-17-15(13)16-3/h4-9H,10H2,1-3H3,(H,16,17) |
| InChIKey | VHNOHEDQPMJUIR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine?
The IUPAC name of 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine (CID 62464069) is 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine.
What is the SMILES notation for 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine?
The canonical SMILES for 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine is CNc1ncccc1COc1cccc(C)c1C.
What is the InChIKey of 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine?
The InChIKey is VHNOHEDQPMJUIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O/c1-11-6-4-8-14(12(11)2)18-10-13-7-5-9-17-15(13)16-3/h4-9H,10H2,1-3H3,(H,16,17).
What are the key properties of 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine?
3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine has a molecular weight of 242.32 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dimethylphenoxy)methyl]-N-methylpyridin-2-amine is sourced from PubChem (CID 62464069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).