C13H11Br3N2O — CID 63485474
N-methyl-3-[(2,4,6-tribromophenoxy)methyl]pyridin-2-amine (PubChem CID 63485474) has the molecular formula C13H11Br3N2O and a molecular weight of 450.96 g/mol. Its IUPAC name is N-methyl-3-[(2,4,6-tribromophenoxy)methyl]pyridin-2-amine.
| Compound Name | N-methyl-3-[(2,4,6-tribromophenoxy)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 63485474 |
| Molecular Formula | C13H11Br3N2O |
| Molecular Weight | 450.96 g/mol |
| Exact Mass | 447.84 |
| IUPAC Name | N-methyl-3-[(2,4,6-tribromophenoxy)methyl]pyridin-2-amine |
| SMILES | CNc1ncccc1COc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C13H11Br3N2O/c1-17-13-8(3-2-4-18-13)7-19-12-10(15)5-9(14)6-11(12)16/h2-6H,7H2,1H3,(H,17,18) |
| InChIKey | YESDYEMNBMRUKA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |