C23H33FN4O2 — CID 162800428
N-cyclohexyl-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxamide (PubChem CID 162800428) has the molecular formula C23H33FN4O2 and a molecular weight of 416.54 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxamide.
| Compound Name | N-cyclohexyl-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 162800428 |
| Molecular Formula | C23H33FN4O2 |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | N-cyclohexyl-2-(2-fluorobenzoyl)-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-8-carboxamide |
| SMILES | CC1(C)CN(C(=O)c2ccccc2F)CC2CN(C(=O)NC3CCCCC3)CCN21 |
| InChI | InChI=1S/C23H33FN4O2/c1-23(2)16-27(21(29)19-10-6-7-11-20(19)24)15-18-14-26(12-13-28(18)23)22(30)25-17-8-4-3-5-9-17/h6-7,10-11,17-18H,3-5,8-9,12-16H2,1-2H3,(H,25,30) |
| InChIKey | FODZOHHADHNQEI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |