C37H35ClF3N3O2 — CID 140571408
(3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide (PubChem CID 140571408) has the molecular formula C37H35ClF3N3O2 and a molecular weight of 646.15 g/mol. Its IUPAC name is (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide.
| Compound Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide |
|---|---|
| PubChem CID | 140571408 |
| Molecular Formula | C37H35ClF3N3O2 |
| Molecular Weight | 646.15 g/mol |
| Exact Mass | 645.24 |
| IUPAC Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[(4-chlorophenyl)methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C(=Cc1ccc(C(F)(F)F)cc1)[C@H](Cc1ccccc1)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C37H35ClF3N3O2/c38-32-17-13-29(14-18-32)25-42-35(45)33(23-28-11-15-31(16-12-28)37(39,40)41)34(24-27-7-3-1-4-8-27)36(46)44-21-19-43(20-22-44)26-30-9-5-2-6-10-30/h1-18,23,34H,19-22,24-26H2,(H,42,45)/t34-/m0/s1 |
| InChIKey | PQMKHQDFOBXHJP-UMSFTDKQSA-N |
| XLogP | 7.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.15 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|