C36H35F3N4O2 — CID 140571435
(3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-4-oxo-N-(pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide (PubChem CID 140571435) has the molecular formula C36H35F3N4O2 and a molecular weight of 612.70 g/mol. Its IUPAC name is (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-4-oxo-N-(pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide.
| Compound Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-4-oxo-N-(pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide |
|---|---|
| PubChem CID | 140571435 |
| Molecular Formula | C36H35F3N4O2 |
| Molecular Weight | 612.70 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-4-oxo-N-(pyridin-3-ylmethyl)-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide |
| SMILES | O=C(NCc1cccnc1)C(=Cc1ccc(C(F)(F)F)cc1)[C@H](Cc1ccccc1)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C36H35F3N4O2/c37-36(38,39)31-15-13-28(14-16-31)22-32(34(44)41-25-30-12-7-17-40-24-30)33(23-27-8-3-1-4-9-27)35(45)43-20-18-42(19-21-43)26-29-10-5-2-6-11-29/h1-17,22,24,33H,18-21,23,25-26H2,(H,41,44)/t33-/m0/s1 |
| InChIKey | BOMNACPZRPIQOS-XIFFEERXSA-N |
| XLogP | 6.00 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|