C42H42N4O2 — CID 140571462
(3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-2-[(4-methylphenyl)methylidene]-4-oxo-N-[(4-pyridin-2-ylphenyl)methyl]butanamide (PubChem CID 140571462) has the molecular formula C42H42N4O2 and a molecular weight of 634.82 g/mol. Its IUPAC name is (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-2-[(4-methylphenyl)methylidene]-4-oxo-N-[(4-pyridin-2-ylphenyl)methyl]butanamide.
| Compound Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-2-[(4-methylphenyl)methylidene]-4-oxo-N-[(4-pyridin-2-ylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 140571462 |
| Molecular Formula | C42H42N4O2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-2-[(4-methylphenyl)methylidene]-4-oxo-N-[(4-pyridin-2-ylphenyl)methyl]butanamide |
| SMILES | Cc1ccc(C=C(C(=O)NCc2ccc(-c3ccccn3)cc2)[C@H](Cc2ccccc2)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C42H42N4O2/c1-32-15-17-34(18-16-32)28-38(41(47)44-30-35-19-21-37(22-20-35)40-14-8-9-23-43-40)39(29-33-10-4-2-5-11-33)42(48)46-26-24-45(25-27-46)31-36-12-6-3-7-13-36/h2-23,28,39H,24-27,29-31H2,1H3,(H,44,47)/t39-/m0/s1 |
| InChIKey | YTSYYOJFNUCSEZ-KDXMTYKHSA-N |
| XLogP | 6.96 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|