C39H42F3N5O3 — CID 140571479
(3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[[6-(2-methoxyethylamino)-3-pyridinyl]methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide (PubChem CID 140571479) has the molecular formula C39H42F3N5O3 and a molecular weight of 685.79 g/mol. Its IUPAC name is (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[[6-(2-methoxyethylamino)-3-pyridinyl]methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide.
| Compound Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[[6-(2-methoxyethylamino)-3-pyridinyl]methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide |
|---|---|
| PubChem CID | 140571479 |
| Molecular Formula | C39H42F3N5O3 |
| Molecular Weight | 685.79 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | (3S)-3-benzyl-4-(4-benzylpiperazin-1-yl)-N-[[6-(2-methoxyethylamino)-3-pyridinyl]methyl]-4-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]butanamide |
| SMILES | COCCNc1ccc(CNC(=O)C(=Cc2ccc(C(F)(F)F)cc2)[C@H](Cc2ccccc2)C(=O)N2CCN(Cc3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C39H42F3N5O3/c1-50-23-18-43-36-17-14-32(26-44-36)27-45-37(48)34(24-30-12-15-33(16-13-30)39(40,41)42)35(25-29-8-4-2-5-9-29)38(49)47-21-19-46(20-22-47)28-31-10-6-3-7-11-31/h2-17,24,26,35H,18-23,25,27-28H2,1H3,(H,43,44)(H,45,48)/t35-/m0/s1 |
| InChIKey | ZPGHNAMIJWUDDE-DHUJRADRSA-N |
| XLogP | 6.06 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.79 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|