C23H24F3N3O2 — CID 30457276
N-benzyl-2-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide (PubChem CID 30457276) has the molecular formula C23H24F3N3O2 and a molecular weight of 431.46 g/mol. Its IUPAC name is N-benzyl-2-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30457276 |
| Molecular Formula | C23H24F3N3O2 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-benzyl-2-[4-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)/C=C/c2ccc(C(F)(F)F)cc2)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C23H24F3N3O2/c24-23(25,26)20-9-6-18(7-10-20)8-11-22(31)29-14-12-28(13-15-29)17-21(30)27-16-19-4-2-1-3-5-19/h1-11H,12-17H2,(H,27,30)/b11-8+ |
| InChIKey | LVHFQQHSHHFOEE-DHZHZOJOSA-N |
| XLogP | 3.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|