C24H30N2O — CID 42697658
1-cyclohexyl-3-(4-methylphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea (PubChem CID 42697658) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-methylphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea.
| Compound Name | 1-cyclohexyl-3-(4-methylphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea |
|---|---|
| PubChem CID | 42697658 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-cyclohexyl-3-(4-methylphenyl)-1-[(E)-2-methyl-3-phenylprop-2-enyl]urea |
| SMILES | C/C(=C\c1ccccc1)CN(C(=O)Nc1ccc(C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C24H30N2O/c1-19-13-15-22(16-14-19)25-24(27)26(23-11-7-4-8-12-23)18-20(2)17-21-9-5-3-6-10-21/h3,5-6,9-10,13-17,23H,4,7-8,11-12,18H2,1-2H3,(H,25,27)/b20-17+ |
| InChIKey | BZJUHRBINRVINX-LVZFUZTISA-N |
| XLogP | 6.27 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |