C24H27F3N2O — CID 42697656
1-cyclohexyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 42697656) has the molecular formula C24H27F3N2O and a molecular weight of 416.49 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-cyclohexyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 42697656 |
| Molecular Formula | C24H27F3N2O |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-cyclohexyl-1-[(E)-2-methyl-3-phenylprop-2-enyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | C/C(=C\c1ccccc1)CN(C(=O)Nc1cccc(C(F)(F)F)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H27F3N2O/c1-18(15-19-9-4-2-5-10-19)17-29(22-13-6-3-7-14-22)23(30)28-21-12-8-11-20(16-21)24(25,26)27/h2,4-5,8-12,15-16,22H,3,6-7,13-14,17H2,1H3,(H,28,30)/b18-15+ |
| InChIKey | VXUPURQAFKHYTL-OBGWFSINSA-N |
| XLogP | 6.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |